Products 249633-89-4
CAS 249633-89-4 is the registry number for 3,5-Bis((phenoxycarbonyl)amino)benzoic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3,5-bis(phenoxycarbonylamino)benzoic acid (CAS 249633-89-4) is a chemical compound with the molecular formula C21H16N2O6 and a molecular weight of 392.4 g/mol. IUPAC name: 3,5-bis(phenoxycarbonylamino)benzoic acid. InChIKey: VWIQLNRDEQQYQH-UHFFFAOYSA-N.
| Molecular formula | C21H16N2O6 |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | 3,5-bis(phenoxycarbonylamino)benzoic acid |
| InChIKey | VWIQLNRDEQQYQH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC(=O)NC2=CC(=CC(=C2)C(=O)O)NC(=O)OC3=CC=CC=C3 |
Computed by PubChem (NCBI)