Products 3052551-19-3
CAS 3052551-19-3 is the registry number for FXIIa-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1-aminoisoquinolin-6-yl) 6,7-dimethoxy-2-oxochromene-3-carboxylate (CAS 3052551-19-3) is a chemical compound with the molecular formula C21H16N2O6 and a molecular weight of 392.4 g/mol. IUPAC name: (1-aminoisoquinolin-6-yl) 6,7-dimethoxy-2-oxochromene-3-carboxylate. InChIKey: MRKFVLTUFONGMP-UHFFFAOYSA-N.
| Molecular formula | C21H16N2O6 |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | (1-aminoisoquinolin-6-yl) 6,7-dimethoxy-2-oxochromene-3-carboxylate |
| InChIKey | MRKFVLTUFONGMP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C=C(C(=O)O2)C(=O)OC3=CC4=C(C=C3)C(=NC=C4)N)OC |
Computed by PubChem (NCBI)
Synonyms:
FXIIa-IN-1, orb1942405