Products 249766-86-7

CAS 249766-86-7 is the registry number for tert-Butyl geranyl carbonate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

Tert-butyl [(2E)-3,7-dimethylocta-2,6-dienyl] carbonate (CAS 249766-86-7) is a chemical compound with the molecular formula C15H26O3 and a molecular weight of 254.36 g/mol. IUPAC name: tert-butyl [(2E)-3,7-dimethylocta-2,6-dienyl] carbonate. InChIKey: ZVROHSSMXOIDPT-JLHYYAGUSA-N.

Identity
Molecular formulaC15H26O3
Molecular weight254.36 g/mol
IUPAC nametert-butyl [(2E)-3,7-dimethylocta-2,6-dienyl] carbonate
InChIKeyZVROHSSMXOIDPT-JLHYYAGUSA-N
SMILESCC(=CCC/C(=C/COC(=O)OC(C)(C)C)/C)C

Computed by PubChem (NCBI)