Products 110557-39-6
CAS 110557-39-6 is the registry number for Albrassitriol. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg, 50mg, Get quote.
(1S,4R,4aS,8aS)-4-(hydroxymethyl)-3,4a,8,8-tetramethyl-5,6,7,8a-tetrahydro-1H-naphthalene-1,4-diol (CAS 110557-39-6) is a chemical compound with the molecular formula C15H26O3 and a molecular weight of 254.36 g/mol. IUPAC name: (1S,4R,4aS,8aS)-4-(hydroxymethyl)-3,4a,8,8-tetramethyl-5,6,7,8a-tetrahydro-1H-naphthalene-1,4-diol. InChIKey: RWPFZPBMMIWKKY-NZBPQXDJSA-N.
| Molecular formula | C15H26O3 |
|---|---|
| Molecular weight | 254.36 g/mol |
| IUPAC name | (1S,4R,4aS,8aS)-4-(hydroxymethyl)-3,4a,8,8-tetramethyl-5,6,7,8a-tetrahydro-1H-naphthalene-1,4-diol |
| InChIKey | RWPFZPBMMIWKKY-NZBPQXDJSA-N |
| SMILES | CC1=C[C@@H]([C@@H]2[C@@]([C@]1(CO)O)(CCCC2(C)C)C)O |
Computed by PubChem (NCBI)