Products 250274-93-2

CAS 250274-93-2 is the registry number for Ethyl-(S)-pyrrolidin-3-yl-carbamic acid tert-butyl ester. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-ethyl-N-[(3S)-pyrrolidin-3-yl]carbamate (CAS 250274-93-2) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl N-ethyl-N-[(3S)-pyrrolidin-3-yl]carbamate. InChIKey: YSSKLKKEUPUEEM-VIFPVBQESA-N.

Identity
Molecular formulaC11H22N2O2
Molecular weight214.30 g/mol
IUPAC nametert-butyl N-ethyl-N-[(3S)-pyrrolidin-3-yl]carbamate
InChIKeyYSSKLKKEUPUEEM-VIFPVBQESA-N
SMILESCCN([C@H]1CCNC1)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)