Products 250275-12-8
CAS 250275-12-8 is the registry number for rel-tert-Butyl (((3aR,6aS)-tetrahydro-1H-furo[3,4-c]pyrrol-3a(3H)-yl)methyl)carbamate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl N-[[(3aS,6aR)-1,3,4,5,6,6a-hexahydrofuro[3,4-c]pyrrol-3a-yl]methyl]carbamate (CAS 250275-12-8) is a chemical compound with the molecular formula C12H22N2O3 and a molecular weight of 242.31 g/mol. IUPAC name: tert-butyl N-[[(3aS,6aR)-1,3,4,5,6,6a-hexahydrofuro[3,4-c]pyrrol-3a-yl]methyl]carbamate. InChIKey: CVEXFOCUPOTBEC-BXKDBHETSA-N.
| Molecular formula | C12H22N2O3 |
|---|---|
| Molecular weight | 242.31 g/mol |
| IUPAC name | tert-butyl N-[[(3aS,6aR)-1,3,4,5,6,6a-hexahydrofuro[3,4-c]pyrrol-3a-yl]methyl]carbamate |
| InChIKey | CVEXFOCUPOTBEC-BXKDBHETSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@]12CNC[C@@H]1COC2 |
Computed by PubChem (NCBI)