Products 2504147-17-3
CAS 2504147-17-3 is the registry number for Cis-(3-amino-cyclohexyl)-carbamic acid benzyl ester hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Benzyl N-[(1R,3S)-3-aminocyclohexyl]carbamate;hydrochloride (CAS 2504147-17-3) is a chemical compound with the molecular formula C14H21ClN2O2 and a molecular weight of 284.78 g/mol. IUPAC name: benzyl N-[(1R,3S)-3-aminocyclohexyl]carbamate;hydrochloride. InChIKey: SBODKRLYZILWEM-JHEYCYPBSA-N.
| Molecular formula | C14H21ClN2O2 |
|---|---|
| Molecular weight | 284.78 g/mol |
| IUPAC name | benzyl N-[(1R,3S)-3-aminocyclohexyl]carbamate;hydrochloride |
| InChIKey | SBODKRLYZILWEM-JHEYCYPBSA-N |
| SMILES | C1C[C@@H](C[C@@H](C1)NC(=O)OCC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
cis-(3-Amino-cyclohexyl)-carbamic acid benzyl ester; hydrochloride, Benzyl trans-3-aminocyclohexylcarbamatehydrochloride, Benzyl ((1R,3S)-3-aminocyclohexyl)carbamate hydrochloride, benzyl N-[(1R,3S)-3-aminocyclohexyl]carbamate;hydrochloride, Cis-(3-amino-cyclohexyl)-carbamic acid benzyl ester hydrochloride