Products 2504201-52-7

CAS 2504201-52-7 is the registry number for 2,2-Dimethyl-succinic acid 1-(2,5-dioxo-pyrrolidin-1-yl) ester 4-methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-O-(2,5-dioxopyrrolidin-1-yl) 1-O-methyl 2,2-dimethylbutanedioate (CAS 2504201-52-7) is a chemical compound with the molecular formula C11H15NO6 and a molecular weight of 257.24 g/mol. IUPAC name: 4-O-(2,5-dioxopyrrolidin-1-yl) 1-O-methyl 2,2-dimethylbutanedioate. InChIKey: AOELKTKZJRDJDV-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15NO6
Molecular weight257.24 g/mol
IUPAC name4-O-(2,5-dioxopyrrolidin-1-yl) 1-O-methyl 2,2-dimethylbutanedioate
InChIKeyAOELKTKZJRDJDV-UHFFFAOYSA-N
SMILESCC(C)(CC(=O)ON1C(=O)CCC1=O)C(=O)OC

Computed by PubChem (NCBI)