Products 74648-13-8

CAS 74648-13-8 is the registry number for 7-((2,5-Dioxopyrrolidin-1-yl)oxy)-7-oxoheptanoic acid, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

7-(2,5-dioxopyrrolidin-1-yl)oxy-7-oxoheptanoic acid (CAS 74648-13-8) is a chemical compound with the molecular formula C11H15NO6 and a molecular weight of 257.24 g/mol. IUPAC name: 7-(2,5-dioxopyrrolidin-1-yl)oxy-7-oxoheptanoic acid. InChIKey: XPQVQBKWJUHXJN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15NO6
Molecular weight257.24 g/mol
IUPAC name7-(2,5-dioxopyrrolidin-1-yl)oxy-7-oxoheptanoic acid
InChIKeyXPQVQBKWJUHXJN-UHFFFAOYSA-N
SMILESC1CC(=O)N(C1=O)OC(=O)CCCCCC(=O)O

Computed by PubChem (NCBI)