CAS 2504203-74-9 is the registry number for 4-((3-Bromo-4-fluorophenoxy)methyl)-2,2-dimethyl-1,3-dioxolane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-[(3-bromo-4-fluorophenoxy)methyl]-2,2-dimethyl-1,3-dioxolane (CAS 2504203-74-9) is a chemical compound with the molecular formula C12H14BrFO3 and a molecular weight of 305.14 g/mol. IUPAC name: 4-[(3-bromo-4-fluorophenoxy)methyl]-2,2-dimethyl-1,3-dioxolane. InChIKey: CPIGBMIEWLDAMG-UHFFFAOYSA-N.
| Molecular formula | C12H14BrFO3 |
|---|---|
| Molecular weight | 305.14 g/mol |
| IUPAC name | 4-[(3-bromo-4-fluorophenoxy)methyl]-2,2-dimethyl-1,3-dioxolane |
| InChIKey | CPIGBMIEWLDAMG-UHFFFAOYSA-N |
| SMILES | CC1(OCC(O1)COC2=CC(=C(C=C2)F)Br)C |
Computed by PubChem (NCBI)