Products 2635937-47-0
CAS 2635937-47-0 is the registry number for Tert-butyl 2-bromo-6-fluoro-3-methoxybenzoate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl 2-bromo-6-fluoro-3-methoxybenzoate (CAS 2635937-47-0) is a chemical compound with the molecular formula C12H14BrFO3 and a molecular weight of 305.14 g/mol. IUPAC name: tert-butyl 2-bromo-6-fluoro-3-methoxybenzoate. InChIKey: CQDRHYIBPLSYSJ-UHFFFAOYSA-N.
| Molecular formula | C12H14BrFO3 |
|---|---|
| Molecular weight | 305.14 g/mol |
| IUPAC name | tert-butyl 2-bromo-6-fluoro-3-methoxybenzoate |
| InChIKey | CQDRHYIBPLSYSJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=CC(=C1Br)OC)F |
Computed by PubChem (NCBI)