Products 2504233-95-6
CAS 2504233-95-6 is the registry number for 6-(Chloromethyl)-1-(4-methoxybenzyl)benzo[cd]indol-2(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(chloromethyl)-1-[(4-methoxyphenyl)methyl]benzo[cd]indol-2-one (CAS 2504233-95-6) is a chemical compound with the molecular formula C20H16ClNO2 and a molecular weight of 337.8 g/mol. IUPAC name: 6-(chloromethyl)-1-[(4-methoxyphenyl)methyl]benzo[cd]indol-2-one. InChIKey: GFPRLAFECMONSH-UHFFFAOYSA-N.
| Molecular formula | C20H16ClNO2 |
|---|---|
| Molecular weight | 337.8 g/mol |
| IUPAC name | 6-(chloromethyl)-1-[(4-methoxyphenyl)methyl]benzo[cd]indol-2-one |
| InChIKey | GFPRLAFECMONSH-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN2C3=C4C(=C(C=C3)CCl)C=CC=C4C2=O |
Computed by PubChem (NCBI)