Products 7497-59-8
CAS 7497-59-8 is the registry number for (2-Amino-5-chlorophenyl)(4-methoxyphenyl)methanone. Offered by: Biosynth. Available pack sizes: 0,5g, 0,25g, 1g.
[2-(2-amino-5-chlorophenyl)phenyl]-(4-methoxyphenyl)methanone (CAS 7497-59-8) is a chemical compound with the molecular formula C20H16ClNO2 and a molecular weight of 337.8 g/mol. IUPAC name: [2-(2-amino-5-chlorophenyl)phenyl]-(4-methoxyphenyl)methanone. InChIKey: JLCJSAFKKKQGBQ-UHFFFAOYSA-N.
| Molecular formula | C20H16ClNO2 |
|---|---|
| Molecular weight | 337.8 g/mol |
| IUPAC name | [2-(2-amino-5-chlorophenyl)phenyl]-(4-methoxyphenyl)methanone |
| InChIKey | JLCJSAFKKKQGBQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C2=CC=CC=C2C3=C(C=CC(=C3)Cl)N |
Computed by PubChem (NCBI)