Products 2504236-83-1
CAS 2504236-83-1 is the registry number for 6-Bromopyrrolo[4,3,2-ij]isoquinolin-2(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
9-bromo-2,11-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-one (CAS 2504236-83-1) is a chemical compound with the molecular formula C10H5BrN2O and a molecular weight of 249.06 g/mol. IUPAC name: 9-bromo-2,11-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-one. InChIKey: GUNIAYCRECDSGC-UHFFFAOYSA-N.
| Molecular formula | C10H5BrN2O |
|---|---|
| Molecular weight | 249.06 g/mol |
| IUPAC name | 9-bromo-2,11-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-one |
| InChIKey | GUNIAYCRECDSGC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C(=O)NC3=NC=C2Br |
Computed by PubChem (NCBI)