CAS 304904-69-6 is the registry number for 3-Bromo-4-oxo-1,4-dihydro-quinoline-6-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
3-bromo-4-oxo-1H-quinoline-6-carbonitrile (CAS 304904-69-6) is a chemical compound with the molecular formula C10H5BrN2O and a molecular weight of 249.06 g/mol. IUPAC name: 3-bromo-4-oxo-1H-quinoline-6-carbonitrile. InChIKey: GLZWKDYMBRFFDV-UHFFFAOYSA-N.
| Molecular formula | C10H5BrN2O |
|---|---|
| Molecular weight | 249.06 g/mol |
| IUPAC name | 3-bromo-4-oxo-1H-quinoline-6-carbonitrile |
| InChIKey | GLZWKDYMBRFFDV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C#N)C(=O)C(=CN2)Br |
Computed by PubChem (NCBI)