CAS 2505-31-9 appears in our catalog under these names: 2,4,6-Trichlorophenyl isocyanate, 95%, 2,4,6-Trichlorophenyl Isocyanate, 2,4,6–Trichlorophenyl Isocyanate, 2,4,6-Trichlorophenyl Isocyanate, >98.0%(GC), Benzene, 1,3,5-trichloro-2-isocyanato-, 98.0%, 98.0%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Chemat. Available pack sizes: 5g, 1g, 2,5g.
1,3,5-trichloro-2-isocyanatobenzene (CAS 2505-31-9) is a chemical compound with the molecular formula C7H2Cl3NO and a molecular weight of 222.5 g/mol. IUPAC name: 1,3,5-trichloro-2-isocyanatobenzene. InChIKey: VDYWXVDWKFAUKE-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl3NO |
|---|---|
| Molecular weight | 222.5 g/mol |
| IUPAC name | 1,3,5-trichloro-2-isocyanatobenzene |
| InChIKey | VDYWXVDWKFAUKE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)N=C=O)Cl)Cl |
Computed by PubChem (NCBI)