CAS 6481-01-2 is the registry number for 2,5,7-Trichloro-1,3-benzoxazole, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2,5,7-trichloro-1,3-benzoxazole (CAS 6481-01-2) is a chemical compound with the molecular formula C7H2Cl3NO and a molecular weight of 222.5 g/mol. IUPAC name: 2,5,7-trichloro-1,3-benzoxazole. InChIKey: PWYDOMHIKFHJIW-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl3NO |
|---|---|
| Molecular weight | 222.5 g/mol |
| IUPAC name | 2,5,7-trichloro-1,3-benzoxazole |
| InChIKey | PWYDOMHIKFHJIW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1N=C(O2)Cl)Cl)Cl |
Computed by PubChem (NCBI)