CAS 2505498-74-6 is the registry number for AR ligand-32. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-chloro-N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]pyrazine-2-carboxamide (CAS 2505498-74-6) is a chemical compound with the molecular formula C18H16Cl2N4O2 and a molecular weight of 391.2 g/mol. IUPAC name: 5-chloro-N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]pyrazine-2-carboxamide. InChIKey: BQBAAYVHFGZIPF-UHFFFAOYSA-N.
| Molecular formula | C18H16Cl2N4O2 |
|---|---|
| Molecular weight | 391.2 g/mol |
| IUPAC name | 5-chloro-N-[4-(3-chloro-4-cyanophenoxy)cyclohexyl]pyrazine-2-carboxamide |
| InChIKey | BQBAAYVHFGZIPF-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1NC(=O)C2=CN=C(C=N2)Cl)OC3=CC(=C(C=C3)C#N)Cl |
Computed by PubChem (NCBI)