CAS 250650-97-6 appears in our catalog under these names: Methyl 2,4,6-trimethyl-3-nitrobenzoate, 95%, Methyl 2,4,6-trimethyl-3-nitrobenzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
Methyl 2,4,6-trimethyl-3-nitrobenzoate (CAS 250650-97-6) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: methyl 2,4,6-trimethyl-3-nitrobenzoate. InChIKey: QZDCQHUTGCJJJT-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | methyl 2,4,6-trimethyl-3-nitrobenzoate |
| InChIKey | QZDCQHUTGCJJJT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C(=O)OC)C)[N+](=O)[O-])C |
Computed by PubChem (NCBI)