Products 2507846-03-7
CAS 2507846-03-7 is the registry number for Methyl (2R)-2-fluorotetrahydro-1H-pyrrolizine-7a(5H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate (CAS 2507846-03-7) is a chemical compound with the molecular formula C9H14FNO2 and a molecular weight of 187.21 g/mol. IUPAC name: methyl (2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate. InChIKey: FSIUNPRMYQMELM-YOXFSPIKSA-N.
| Molecular formula | C9H14FNO2 |
|---|---|
| Molecular weight | 187.21 g/mol |
| IUPAC name | methyl (2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carboxylate |
| InChIKey | FSIUNPRMYQMELM-YOXFSPIKSA-N |
| SMILES | COC(=O)C12CCCN1C[C@@H](C2)F |
Computed by PubChem (NCBI)