Products 2823363-17-1
CAS 2823363-17-1 is the registry number for tert-Butyl 3-(fluoromethylene)azetidine-1-carboxylate, 98%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 250mg.
Tert-butyl 3-(fluoromethylidene)azetidine-1-carboxylate (CAS 2823363-17-1) is a chemical compound with the molecular formula C9H14FNO2 and a molecular weight of 187.21 g/mol. IUPAC name: tert-butyl 3-(fluoromethylidene)azetidine-1-carboxylate. InChIKey: ICYHHPXRDPYNNE-UHFFFAOYSA-N.
| Molecular formula | C9H14FNO2 |
|---|---|
| Molecular weight | 187.21 g/mol |
| IUPAC name | tert-butyl 3-(fluoromethylidene)azetidine-1-carboxylate |
| InChIKey | ICYHHPXRDPYNNE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=CF)C1 |
Computed by PubChem (NCBI)