Products 2507994-61-6
CAS 2507994-61-6 appears in our catalog under these names: Phenylethanolamine A–d3, Phenylethanolamine A-d3, 97.0%, D3-Phenylethanolamine A, ISO 17034 RM, D3-Phenylethanolamine A, 100 µg/ml in Acetonitrile, ISO 17034 CRM. Offered by: GLPBio, MedChemExpress, HPC Standards, Chemat. Available pack sizes: 10mg, 5mg, 1 mg, 5 mg, 10 mg, 1ml, 1mg.
2-[4-(4-nitrophenyl)butan-2-ylamino]-1-[4-(trideuteriomethoxy)phenyl]ethanol (CAS 2507994-61-6) is a chemical compound with the molecular formula C19H24N2O4 and a molecular weight of 347.4 g/mol. IUPAC name: 2-[4-(4-nitrophenyl)butan-2-ylamino]-1-[4-(trideuteriomethoxy)phenyl]ethanol. InChIKey: DVUFPRMEKXKECP-BMSJAHLVSA-N.
| Molecular formula | C19H24N2O4 |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | 2-[4-(4-nitrophenyl)butan-2-ylamino]-1-[4-(trideuteriomethoxy)phenyl]ethanol |
| InChIKey | DVUFPRMEKXKECP-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC=C(C=C1)C(CNC(C)CCC2=CC=C(C=C2)[N+](=O)[O-])O |
Computed by PubChem (NCBI)