CAS 2508-80-7 appears in our catalog under these names: 1-(Diaminomethylene)-3-(beta-D-ribofuranosyl)urea, 95%, Azacitidine Impurity 38, Azacitidine Impurity P, (Beta)-1-D-Ribofuranosyl-3-guanylurea. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg, 50mg, 5mg.
1-(diaminomethylidene)-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]urea (CAS 2508-80-7) is a chemical compound with the molecular formula C7H14N4O5 and a molecular weight of 234.21 g/mol. IUPAC name: 1-(diaminomethylidene)-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]urea. InChIKey: KSNSQOVBNYYHLW-TXICZTDVSA-N.
| Molecular formula | C7H14N4O5 |
|---|---|
| Molecular weight | 234.21 g/mol |
| IUPAC name | 1-(diaminomethylidene)-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]urea |
| InChIKey | KSNSQOVBNYYHLW-TXICZTDVSA-N |
| SMILES | C([C@@H]1[C@H]([C@H]([C@@H](O1)NC(=O)N=C(N)N)O)O)O |
Computed by PubChem (NCBI)