CAS 2775292-14-1 appears in our catalog under these names: Azacitidine Impurity 6, N-(Imino(Beta-D-ribofuranosylamino)methyl)urea. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
[N'-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]carbamimidoyl]urea (CAS 2775292-14-1) is a chemical compound with the molecular formula C7H14N4O5 and a molecular weight of 234.21 g/mol. IUPAC name: [N'-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]carbamimidoyl]urea. InChIKey: CIJYDUAJRTVZLU-TXICZTDVSA-N.
| Molecular formula | C7H14N4O5 |
|---|---|
| Molecular weight | 234.21 g/mol |
| IUPAC name | [N'-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]carbamimidoyl]urea |
| InChIKey | CIJYDUAJRTVZLU-TXICZTDVSA-N |
| SMILES | C([C@@H]1[C@H]([C@H]([C@@H](O1)N=C(N)NC(=O)N)O)O)O |
Computed by PubChem (NCBI)