CAS 2511250-80-7 appears in our catalog under these names: cis-3-Methoxycyclopentan-1-amine hydrochloride, 97%, cis-3-Methoxycyclopentan-1-amine hydrochloride 95%, cis-3-methoxycyclopentanamine,hydrochloride, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 250mg, 100mg, 1g, 10g, 5g.
Cis-(1S,3R)-3-methoxycyclopentan-1-amine;hydrochloride (CAS 2511250-80-7) is a chemical compound with the molecular formula C6H14ClNO and a molecular weight of 151.63 g/mol. IUPAC name: cis-(1S,3R)-3-methoxycyclopentan-1-amine;hydrochloride. InChIKey: OYCZONWJWLKAEF-RIHPBJNCSA-N.
| Molecular formula | C6H14ClNO |
|---|---|
| Molecular weight | 151.63 g/mol |
| IUPAC name | cis-(1S,3R)-3-methoxycyclopentan-1-amine;hydrochloride |
| InChIKey | OYCZONWJWLKAEF-RIHPBJNCSA-N |
| SMILES | CO[C@@H]1CC[C@@H](C1)N.Cl |
Computed by PubChem (NCBI)