Products 2512209-14-0
CAS 2512209-14-0 is the registry number for 9-(4’-Hydroxyaminophenyl)-9H-pyrido(3,4-b)indole Hydrochloride. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
N-(4-pyrido[3,4-b]indol-9-ylphenyl)hydroxylamine;hydrochloride (CAS 2512209-14-0) is a chemical compound with the molecular formula C17H14ClN3O and a molecular weight of 311.8 g/mol. IUPAC name: N-(4-pyrido[3,4-b]indol-9-ylphenyl)hydroxylamine;hydrochloride. InChIKey: GVCKCACDUXLJQO-UHFFFAOYSA-N.
| Molecular formula | C17H14ClN3O |
|---|---|
| Molecular weight | 311.8 g/mol |
| IUPAC name | N-(4-pyrido[3,4-b]indol-9-ylphenyl)hydroxylamine;hydrochloride |
| InChIKey | GVCKCACDUXLJQO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2C4=CC=C(C=C4)NO)C=NC=C3.Cl |
Computed by PubChem (NCBI)