CAS 883638-72-0 is the registry number for 4-(1H-Benzimidazol-2-yl)-1-(2-chlorophenyl)pyrrolidin-2-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4-(1H-benzimidazol-2-yl)-1-(2-chlorophenyl)pyrrolidin-2-one (CAS 883638-72-0) is a chemical compound with the molecular formula C17H14ClN3O and a molecular weight of 311.8 g/mol. IUPAC name: 4-(1H-benzimidazol-2-yl)-1-(2-chlorophenyl)pyrrolidin-2-one. InChIKey: WOPRJKMSWGZZAG-UHFFFAOYSA-N.
| Molecular formula | C17H14ClN3O |
|---|---|
| Molecular weight | 311.8 g/mol |
| IUPAC name | 4-(1H-benzimidazol-2-yl)-1-(2-chlorophenyl)pyrrolidin-2-one |
| InChIKey | WOPRJKMSWGZZAG-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)C2=CC=CC=C2Cl)C3=NC4=CC=CC=C4N3 |
Computed by PubChem (NCBI)