CAS 25129-51-5 is the registry number for (2R,3S,4S,5R)-2-(Hydroxymethyl)-5-methoxytetrahydrofuran-3,4-diol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3S,4S,5R)-2-(hydroxymethyl)-5-methoxyoxolane-3,4-diol (CAS 25129-51-5) is a chemical compound with the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. IUPAC name: (2R,3S,4S,5R)-2-(hydroxymethyl)-5-methoxyoxolane-3,4-diol. InChIKey: NALRCAPFICWVAQ-ARQDHWQXSA-N.
| Molecular formula | C6H12O5 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | (2R,3S,4S,5R)-2-(hydroxymethyl)-5-methoxyoxolane-3,4-diol |
| InChIKey | NALRCAPFICWVAQ-ARQDHWQXSA-N |
| SMILES | CO[C@H]1[C@H]([C@@H]([C@H](O1)CO)O)O |
Computed by PubChem (NCBI)