CAS 3795-68-4 appears in our catalog under these names: (2S,3R,4R,5R)-2-(Hydroxymethyl)-5-methoxytetrahydrofuran-3,4-diol, 95%, Methyl a-L-arabinofuranoside. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 100mg, 50mg, 250mg, 500mg.
(2S,3R,4R,5R)-2-(hydroxymethyl)-5-methoxyoxolane-3,4-diol (CAS 3795-68-4) is a chemical compound with the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. IUPAC name: (2S,3R,4R,5R)-2-(hydroxymethyl)-5-methoxyoxolane-3,4-diol. InChIKey: NALRCAPFICWVAQ-UNTFVMJOSA-N.
| Molecular formula | C6H12O5 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | (2S,3R,4R,5R)-2-(hydroxymethyl)-5-methoxyoxolane-3,4-diol |
| InChIKey | NALRCAPFICWVAQ-UNTFVMJOSA-N |
| SMILES | CO[C@H]1[C@@H]([C@H]([C@@H](O1)CO)O)O |
Computed by PubChem (NCBI)