CAS 251327-00-1 is the registry number for Peramivir Impurity 28. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentene-1-carboxylate (CAS 251327-00-1) is a chemical compound with the molecular formula C12H19NO4 and a molecular weight of 241.28 g/mol. IUPAC name: methyl (4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentene-1-carboxylate. InChIKey: BPVUUOLKMLXVJR-VIFPVBQESA-N.
| Molecular formula | C12H19NO4 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | methyl (4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentene-1-carboxylate |
| InChIKey | BPVUUOLKMLXVJR-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC=C(C1)C(=O)OC |
Computed by PubChem (NCBI)