CAS 251460-19-2 is the registry number for Levocarnitine Impurity 28. Offered by: Chemat Brand. Available pack sizes: on request.
[(2S)-2,3-dihydroxypropyl]-trimethylazanium chloride (CAS 251460-19-2) is a chemical compound with the molecular formula C6H16ClNO2 and a molecular weight of 169.65 g/mol. IUPAC name: [(2S)-2,3-dihydroxypropyl]-trimethylazanium chloride. InChIKey: YSRQRFIVCMIJJE-RGMNGODLSA-M.
| Molecular formula | C6H16ClNO2 |
|---|---|
| Molecular weight | 169.65 g/mol |
| IUPAC name | [(2S)-2,3-dihydroxypropyl]-trimethylazanium chloride |
| InChIKey | YSRQRFIVCMIJJE-RGMNGODLSA-M |
| SMILES | C[N+](C)(C)C[C@@H](CO)O.[Cl-] |
Computed by PubChem (NCBI)