Products 251460-19-2

CAS 251460-19-2 is the registry number for Levocarnitine Impurity 28. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[(2S)-2,3-dihydroxypropyl]-trimethylazanium chloride (CAS 251460-19-2) is a chemical compound with the molecular formula C6H16ClNO2 and a molecular weight of 169.65 g/mol. IUPAC name: [(2S)-2,3-dihydroxypropyl]-trimethylazanium chloride. InChIKey: YSRQRFIVCMIJJE-RGMNGODLSA-M.

Identity
Molecular formulaC6H16ClNO2
Molecular weight169.65 g/mol
IUPAC name[(2S)-2,3-dihydroxypropyl]-trimethylazanium chloride
InChIKeyYSRQRFIVCMIJJE-RGMNGODLSA-M
SMILESC[N+](C)(C)C[C@@H](CO)O.[Cl-]

Computed by PubChem (NCBI)