Products 34004-36-9

CAS 34004-36-9 appears in our catalog under these names: 2,3-Dihydroxy-n,n,n-trimethylpropan-1-aminium chloride, 95%, Levocarnitine Impurity 10 Chloride, 2,3–Dihydroxy–N,N,N–trimethylpropan–1–aminium chloride, 2,3-Dihydroxy-N,N,N-trimethylpropan-1-aminium chloride, 2,3-Dihydroxy-N,N,N-trimethylpropan-1-aminium chloride 95%. Offered by: Combi-blocks, Chemat Brand, GLPBio, Biosynth, Ambeed. Available pack sizes: 5g, 25g, 10g, 1g, on request, 2g, 250mg, 100g.

Structural formula: {0} (CAS {1})

2,3-dihydroxypropyl(trimethyl)azanium chloride (CAS 34004-36-9) is a chemical compound with the molecular formula C6H16ClNO2 and a molecular weight of 169.65 g/mol. IUPAC name: 2,3-dihydroxypropyl(trimethyl)azanium chloride. InChIKey: YSRQRFIVCMIJJE-UHFFFAOYSA-M.

Identity
Molecular formulaC6H16ClNO2
Molecular weight169.65 g/mol
IUPAC name2,3-dihydroxypropyl(trimethyl)azanium chloride
InChIKeyYSRQRFIVCMIJJE-UHFFFAOYSA-M
SMILESC[N+](C)(C)CC(CO)O.[Cl-]

Computed by PubChem (NCBI)