Products 2514668-33-6
CAS 2514668-33-6 is the registry number for 3-Bromomethamphetamine Hydrochloride. Offered by: TRC. Available pack sizes: 25mg.
1-(3-bromophenyl)-N-methylpropan-2-amine;hydrochloride (CAS 2514668-33-6) is a chemical compound with the molecular formula C10H15BrClN and a molecular weight of 264.59 g/mol. IUPAC name: 1-(3-bromophenyl)-N-methylpropan-2-amine;hydrochloride. InChIKey: PTFQUMLOJPCXQE-UHFFFAOYSA-N.
| Molecular formula | C10H15BrClN |
|---|---|
| Molecular weight | 264.59 g/mol |
| IUPAC name | 1-(3-bromophenyl)-N-methylpropan-2-amine;hydrochloride |
| InChIKey | PTFQUMLOJPCXQE-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC(=CC=C1)Br)NC.Cl |
Computed by PubChem (NCBI)