CAS 2514709-11-4 appears in our catalog under these names: (R)-Methyl 2-Amino-3-cyclopentylpropanoate Hydrochloride, (R)–Methyl 2–amino–3–cyclopentylpropanoate hydrochloride, (R)-Methyl 2-amino-3-cyclopentylpropanoate hydrochloride, 97%, 97%, (R)-Methyl 2-amino-3-cyclopentylpropanoate hydrochloride, 96%. Offered by: TRC, GLPBio, Chemat, Fluorochem. Available pack sizes: 500mg, 100mg, 250mg, 5g, 1g.
Methyl (2R)-2-amino-3-cyclopentylpropanoate;hydrochloride (CAS 2514709-11-4) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. IUPAC name: methyl (2R)-2-amino-3-cyclopentylpropanoate;hydrochloride. InChIKey: RAGBLBBMRQLNKB-DDWIOCJRSA-N.
| Molecular formula | C9H18ClNO2 |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-cyclopentylpropanoate;hydrochloride |
| InChIKey | RAGBLBBMRQLNKB-DDWIOCJRSA-N |
| SMILES | COC(=O)[C@@H](CC1CCCC1)N.Cl |
Computed by PubChem (NCBI)