Products 2514947-15-8
CAS 2514947-15-8 appears in our catalog under these names: N-Iodoacetyltyramine-d4, N-(4-Hydroxyphenethyl)-2-iodoacetamide-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 5 mg, 10 mg, 1 mg.
2-iodo-N-[1,1,2,2-tetradeuterio-2-(4-hydroxyphenyl)ethyl]acetamide (CAS 2514947-15-8) is a chemical compound with the molecular formula C10H12INO2 and a molecular weight of 309.14 g/mol. IUPAC name: 2-iodo-N-[1,1,2,2-tetradeuterio-2-(4-hydroxyphenyl)ethyl]acetamide. InChIKey: KROHFNRTQBLLOZ-NZLXMSDQSA-N.
| Molecular formula | C10H12INO2 |
|---|---|
| Molecular weight | 309.14 g/mol |
| IUPAC name | 2-iodo-N-[1,1,2,2-tetradeuterio-2-(4-hydroxyphenyl)ethyl]acetamide |
| InChIKey | KROHFNRTQBLLOZ-NZLXMSDQSA-N |
| SMILES | [2H]C([2H])(C1=CC=C(C=C1)O)C([2H])([2H])NC(=O)CI |
Computed by PubChem (NCBI)