Products 2515-36-8
CAS 2515-36-8 appears in our catalog under these names: a-Hydroxymethyl Atropine, >95% (HPLC), alpha-Hydroxymethyl Atropine, >95% (HPLC), α–Hydroxymethyl Atropine, α-Hydroxymethylatropine, (1R,3r,5S)-8-Methyl-8-azabicyclo[3.2.1]octan-3-yl 3-hydroxy-2-(hydroxymethyl)-2-phenylpropanoate, ≥98%, ≥98%. Offered by: TRC, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 500mg, 50mg, 25mg, 0,01g, 0,025g, 0,05g, 0,1g, 10mg.
[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-(hydroxymethyl)-2-phenylpropanoate (CAS 2515-36-8) is a chemical compound with the molecular formula C18H25NO4 and a molecular weight of 319.4 g/mol. IUPAC name: [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-(hydroxymethyl)-2-phenylpropanoate. InChIKey: ICTCLIOSQZBOFS-XYPWUTKMSA-N.
| Molecular formula | C18H25NO4 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-(hydroxymethyl)-2-phenylpropanoate |
| InChIKey | ICTCLIOSQZBOFS-XYPWUTKMSA-N |
| SMILES | CN1[C@@H]2CC[C@H]1CC(C2)OC(=O)C(CO)(CO)C3=CC=CC=C3 |
Computed by PubChem (NCBI)