CAS 25163-88-6 appears in our catalog under these names: 1-tert-Butyl-4-(prop-1-en-2-yl)benzene, 95% mix TBC as stabilizer, 1-tert-Butyl-4-(prop-1-en-2-yl)benzene. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-tert-butyl-4-prop-1-en-2-ylbenzene (CAS 25163-88-6) is a chemical compound with the molecular formula C13H18 and a molecular weight of 174.28 g/mol. IUPAC name: 1-tert-butyl-4-prop-1-en-2-ylbenzene. InChIKey: IHKJXCKVKGBGSQ-UHFFFAOYSA-N.
| Molecular formula | C13H18 |
|---|---|
| Molecular weight | 174.28 g/mol |
| IUPAC name | 1-tert-butyl-4-prop-1-en-2-ylbenzene |
| InChIKey | IHKJXCKVKGBGSQ-UHFFFAOYSA-N |
| SMILES | CC(=C)C1=CC=C(C=C1)C(C)(C)C |
Computed by PubChem (NCBI)