CAS 951891-75-1 is the registry number for 4-(2,4-Dimethylphenyl)-2-methyl-1-butene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dimethyl-1-(3-methylbut-3-enyl)benzene (CAS 951891-75-1) is a chemical compound with the molecular formula C13H18 and a molecular weight of 174.28 g/mol. IUPAC name: 2,4-dimethyl-1-(3-methylbut-3-enyl)benzene. InChIKey: LEQPEGJZBCUOSV-UHFFFAOYSA-N.
| Molecular formula | C13H18 |
|---|---|
| Molecular weight | 174.28 g/mol |
| IUPAC name | 2,4-dimethyl-1-(3-methylbut-3-enyl)benzene |
| InChIKey | LEQPEGJZBCUOSV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)CCC(=C)C)C |
Computed by PubChem (NCBI)