CAS 251645-83-7 is the registry number for (1S,E)-(-)-Camphorquinone 3-oxime, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(1S,3Z,4R)-3-hydroxyimino-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (CAS 251645-83-7) is a chemical compound with the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. IUPAC name: (1S,3Z,4R)-3-hydroxyimino-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one. InChIKey: YRNPDSREMSMKIY-VWXBLIEFSA-N.
| Molecular formula | C10H15NO2 |
|---|---|
| Molecular weight | 181.23 g/mol |
| IUPAC name | (1S,3Z,4R)-3-hydroxyimino-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| InChIKey | YRNPDSREMSMKIY-VWXBLIEFSA-N |
| SMILES | C[C@]12CC[C@H](C1(C)C)/C(=N/O)/C2=O |
Computed by PubChem (NCBI)