CAS 31571-14-9 appears in our catalog under these names: Anti-(1r)-(+)-camphorquinone 3-oxime, 95%, anti–(1R)–(+)–Camphorquinone 3–Oxime, (1R,E)-(+)-Camphorquinone 3-oxime, 99% , anti-(1R)-(+)-Camphorquinone 3-Oxime, >95.0%(GC)(N), anti-(1R)-(+)-Camphorquinone 3-Oxime, 95%+(NMR),RG, 95%+(NMR),RG. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Chemat. Available pack sizes: 1g, 250mg, 200mg, 5g, 100mg.
(1R,3E,4S)-3-hydroxyimino-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (CAS 31571-14-9) is a chemical compound with the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. IUPAC name: (1R,3E,4S)-3-hydroxyimino-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one. InChIKey: YRNPDSREMSMKIY-ULHYPVSZSA-N.
| Molecular formula | C10H15NO2 |
|---|---|
| Molecular weight | 181.23 g/mol |
| IUPAC name | (1R,3E,4S)-3-hydroxyimino-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| InChIKey | YRNPDSREMSMKIY-ULHYPVSZSA-N |
| SMILES | C[C@@]12CC[C@@H](C1(C)C)/C(=N\O)/C2=O |
Computed by PubChem (NCBI)