CAS 25176-72-1 is the registry number for 3-(Benzo[d]thiazol-2-ylthio)propanenitrile, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(1,3-benzothiazol-2-ylsulfanyl)propanenitrile (CAS 25176-72-1) is a chemical compound with the molecular formula C10H8N2S2 and a molecular weight of 220.3 g/mol. IUPAC name: 3-(1,3-benzothiazol-2-ylsulfanyl)propanenitrile. InChIKey: WICPQXGTHCPTGL-UHFFFAOYSA-N.
| Molecular formula | C10H8N2S2 |
|---|---|
| Molecular weight | 220.3 g/mol |
| IUPAC name | 3-(1,3-benzothiazol-2-ylsulfanyl)propanenitrile |
| InChIKey | WICPQXGTHCPTGL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)SCCC#N |
Computed by PubChem (NCBI)