CAS 31879-58-0 is the registry number for 4H-Thiochromeno(4,3-d)(1,3)thiazol-2-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4H-thiochromeno[4,3-d][1,3]thiazol-2-amine (CAS 31879-58-0) is a chemical compound with the molecular formula C10H8N2S2 and a molecular weight of 220.3 g/mol. IUPAC name: 4H-thiochromeno[4,3-d][1,3]thiazol-2-amine. InChIKey: WGBUMKYAWGTOBY-UHFFFAOYSA-N.
| Molecular formula | C10H8N2S2 |
|---|---|
| Molecular weight | 220.3 g/mol |
| IUPAC name | 4H-thiochromeno[4,3-d][1,3]thiazol-2-amine |
| InChIKey | WGBUMKYAWGTOBY-UHFFFAOYSA-N |
| SMILES | C1C2=C(C3=CC=CC=C3S1)N=C(S2)N |
Computed by PubChem (NCBI)