Products 2517940-02-0
CAS 2517940-02-0 is the registry number for 5，5'-(Piperazine-2，5-diyl)bis(2-hydroxybenzamide), 95%, 95%. Offered by: Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg.
5-[5-(3-carbamoyl-4-hydroxyphenyl)piperazin-2-yl]-2-hydroxybenzamide (CAS 2517940-02-0) is a chemical compound with the molecular formula C18H20N4O4 and a molecular weight of 356.4 g/mol. IUPAC name: 5-[5-(3-carbamoyl-4-hydroxyphenyl)piperazin-2-yl]-2-hydroxybenzamide. InChIKey: XTKSAEKIISOABY-UHFFFAOYSA-N.
| Molecular formula | C18H20N4O4 |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | 5-[5-(3-carbamoyl-4-hydroxyphenyl)piperazin-2-yl]-2-hydroxybenzamide |
| InChIKey | XTKSAEKIISOABY-UHFFFAOYSA-N |
| SMILES | C1C(NCC(N1)C2=CC(=C(C=C2)O)C(=O)N)C3=CC(=C(C=C3)O)C(=O)N |
Computed by PubChem (NCBI)