CAS 2924858-30-8 is the registry number for Thalidomide-N-methylpiperazine. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(2,6-dioxopiperidin-3-yl)-5-(4-methylpiperazin-1-yl)isoindole-1,3-dione (CAS 2924858-30-8) is a chemical compound with the molecular formula C18H20N4O4 and a molecular weight of 356.4 g/mol. IUPAC name: 2-(2,6-dioxopiperidin-3-yl)-5-(4-methylpiperazin-1-yl)isoindole-1,3-dione. InChIKey: QCWYNTQEGFDVSU-UHFFFAOYSA-N.
| Molecular formula | C18H20N4O4 |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | 2-(2,6-dioxopiperidin-3-yl)-5-(4-methylpiperazin-1-yl)isoindole-1,3-dione |
| InChIKey | QCWYNTQEGFDVSU-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC3=C(C=C2)C(=O)N(C3=O)C4CCC(=O)NC4=O |
Computed by PubChem (NCBI)