CAS 2518416-79-8 is the registry number for ((3S,4R)-4-(4-Ethoxyphenyl)-1-methylpiperidin-3-yl)methyl Methanesulfonate. Offered by: TRC. Available pack sizes: 500mg.
[(3S,4R)-4-(4-ethoxyphenyl)-1-methylpiperidin-3-yl]methyl methanesulfonate (CAS 2518416-79-8) is a chemical compound with the molecular formula C16H25NO4S and a molecular weight of 327.4 g/mol. IUPAC name: [(3S,4R)-4-(4-ethoxyphenyl)-1-methylpiperidin-3-yl]methyl methanesulfonate. InChIKey: SMEANXMBQMIWDR-HOCLYGCPSA-N.
| Molecular formula | C16H25NO4S |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | [(3S,4R)-4-(4-ethoxyphenyl)-1-methylpiperidin-3-yl]methyl methanesulfonate |
| InChIKey | SMEANXMBQMIWDR-HOCLYGCPSA-N |
| SMILES | CCOC1=CC=C(C=C1)[C@@H]2CCN(C[C@H]2COS(=O)(=O)C)C |
Computed by PubChem (NCBI)