CAS 310450-40-9 is the registry number for tert-Butyl ((2R,3R)-3-hydroxy-4-(p-tolylsulfinyl)butan-2-yl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(2R,3R)-3-hydroxy-4-(4-methylphenyl)sulfinylbutan-2-yl]carbamate (CAS 310450-40-9) is a chemical compound with the molecular formula C16H25NO4S and a molecular weight of 327.4 g/mol. IUPAC name: tert-butyl N-[(2R,3R)-3-hydroxy-4-(4-methylphenyl)sulfinylbutan-2-yl]carbamate. InChIKey: ZKXCFTXCEGRBCU-CIFKBFOQSA-N.
| Molecular formula | C16H25NO4S |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | tert-butyl N-[(2R,3R)-3-hydroxy-4-(4-methylphenyl)sulfinylbutan-2-yl]carbamate |
| InChIKey | ZKXCFTXCEGRBCU-CIFKBFOQSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)C[C@@H]([C@@H](C)NC(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)