CAS 25185-89-1 is the registry number for Dibenzo[b,d]thiophene-3-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Dibenzothiophene-3-carbaldehyde (CAS 25185-89-1) is a chemical compound with the molecular formula C13H8OS and a molecular weight of 212.27 g/mol. IUPAC name: dibenzothiophene-3-carbaldehyde. InChIKey: FFBCUIZXWJMUDW-UHFFFAOYSA-N.
| Molecular formula | C13H8OS |
|---|---|
| Molecular weight | 212.27 g/mol |
| IUPAC name | dibenzothiophene-3-carbaldehyde |
| InChIKey | FFBCUIZXWJMUDW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(S2)C=C(C=C3)C=O |
Computed by PubChem (NCBI)