CAS 4506-53-0 appears in our catalog under these names: 4H-Benzo[4,5]cyclohepta[1,2-b]thiophen-4-one, 95%, 4H-Benzo(4,5)cyclohepta(1,2-b)thiophen-4-one. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,8,10,12-hexaen-2-one (CAS 4506-53-0) is a chemical compound with the molecular formula C13H8OS and a molecular weight of 212.27 g/mol. IUPAC name: 6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,8,10,12-hexaen-2-one. InChIKey: AKYJPOPHGMQXHH-UHFFFAOYSA-N.
| Molecular formula | C13H8OS |
|---|---|
| Molecular weight | 212.27 g/mol |
| IUPAC name | 6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,8,10,12-hexaen-2-one |
| InChIKey | AKYJPOPHGMQXHH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C(C2=O)C=CS3 |
Computed by PubChem (NCBI)