CAS 251924-83-1 appears in our catalog under these names: 1–Boc–DL–Pyroglutamic acid ethyl ester, 1-Boc-DL-Pyroglutamic acid ethyl ester 96%, 1-Boc-DL-Pyroglutamic acid ethyl ester, 97.0%, 1-tert-butyl 2-ethyl 5-oxopyrrolidine-1,2-dicarboxylate, 96%, 96%, 1-TERT-BUTYL 2-ETHYL 5-OXOPYRROLIDINE-1,2-DICARBOXYLATE, 95%. Offered by: GLPBio, Ambeed, MedChemExpress, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g, 100g, 5 g, 10 g, 25 g.
1-O-tert-butyl 2-O-ethyl 5-oxopyrrolidine-1,2-dicarboxylate (CAS 251924-83-1) is a chemical compound with the molecular formula C12H19NO5 and a molecular weight of 257.28 g/mol. IUPAC name: 1-O-tert-butyl 2-O-ethyl 5-oxopyrrolidine-1,2-dicarboxylate. InChIKey: YWWWGFSJHCFVOW-UHFFFAOYSA-N.
| Molecular formula | C12H19NO5 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-ethyl 5-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | YWWWGFSJHCFVOW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCC(=O)N1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)