CAS 251963-74-3 is the registry number for L-708906. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[3,5-bis(phenylmethoxy)phenyl]-2,4-dioxobutanoic acid (CAS 251963-74-3) is a chemical compound with the molecular formula C24H20O6 and a molecular weight of 404.4 g/mol. IUPAC name: 4-[3,5-bis(phenylmethoxy)phenyl]-2,4-dioxobutanoic acid. InChIKey: SLRLQBRWUMWEOZ-UHFFFAOYSA-N.
| Molecular formula | C24H20O6 |
|---|---|
| Molecular weight | 404.4 g/mol |
| IUPAC name | 4-[3,5-bis(phenylmethoxy)phenyl]-2,4-dioxobutanoic acid |
| InChIKey | SLRLQBRWUMWEOZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=CC(=C2)C(=O)CC(=O)C(=O)O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)